C32H45N3O4 — CID 91371103
1-(cyclohexylmethyl)-N-[1-[2-(4-methoxyphenyl)ethylamino]-2-methyl-1-oxopropan-2-yl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide (PubChem CID 91371103) has the molecular formula C32H45N3O4 and a molecular weight of 535.73 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-N-[1-[2-(4-methoxyphenyl)ethylamino]-2-methyl-1-oxopropan-2-yl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide.
| Compound Name | 1-(cyclohexylmethyl)-N-[1-[2-(4-methoxyphenyl)ethylamino]-2-methyl-1-oxopropan-2-yl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91371103 |
| Molecular Formula | C32H45N3O4 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.34 |
| IUPAC Name | 1-(cyclohexylmethyl)-N-[1-[2-(4-methoxyphenyl)ethylamino]-2-methyl-1-oxopropan-2-yl]-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C(C)(C)NC(=O)c2cc3c(n(CC4CCCCC4)c2=O)CCCCCC3)cc1 |
| InChI | InChI=1S/C32H45N3O4/c1-32(2,31(38)33-20-19-23-15-17-26(39-3)18-16-23)34-29(36)27-21-25-13-9-4-5-10-14-28(25)35(30(27)37)22-24-11-7-6-8-12-24/h15-18,21,24H,4-14,19-20,22H2,1-3H3,(H,33,38)(H,34,36) |
| InChIKey | GLLHBRXDLGBGMG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |