C31H52N3O4+ — CID 67520262
butyl-[2-[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]oxyethyl]-dimethylazanium (PubChem CID 67520262) has the molecular formula C31H52N3O4+ and a molecular weight of 530.77 g/mol. Its IUPAC name is butyl-[2-[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]oxyethyl]-dimethylazanium.
| Compound Name | butyl-[2-[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]oxyethyl]-dimethylazanium |
|---|---|
| PubChem CID | 67520262 |
| Molecular Formula | C31H52N3O4+ |
| Molecular Weight | 530.77 g/mol |
| Exact Mass | 530.40 |
| IUPAC Name | butyl-[2-[2-[[1-(cyclohexylmethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]-2-methylpropanoyl]oxyethyl]-dimethylazanium |
| SMILES | CCCC[N+](C)(C)CCOC(=O)C(C)(C)NC(=O)c1cc2c(n(CC3CCCCC3)c1=O)CCCCCC2 |
| InChI | InChI=1S/C31H51N3O4/c1-6-7-19-34(4,5)20-21-38-30(37)31(2,3)32-28(35)26-22-25-17-13-8-9-14-18-27(25)33(29(26)36)23-24-15-11-10-12-16-24/h22,24H,6-21,23H2,1-5H3/p+1 |
| InChIKey | QZKBSNDLHXTKLH-UHFFFAOYSA-O |
| XLogP | 5.02 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.77 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|