C17H22N4O2 — CID 69483781
tert-butyl N-[(1S,4R)-4-[[(5-cyano-2-pyridinyl)amino]methyl]cyclopent-2-en-1-yl]carbamate (PubChem CID 69483781) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R)-4-[[(5-cyano-2-pyridinyl)amino]methyl]cyclopent-2-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R)-4-[[(5-cyano-2-pyridinyl)amino]methyl]cyclopent-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 69483781 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | tert-butyl N-[(1S,4R)-4-[[(5-cyano-2-pyridinyl)amino]methyl]cyclopent-2-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C=C[C@H](CNc2ccc(C#N)cn2)C1 |
| InChI | InChI=1S/C17H22N4O2/c1-17(2,3)23-16(22)21-14-6-4-12(8-14)10-19-15-7-5-13(9-18)11-20-15/h4-7,11-12,14H,8,10H2,1-3H3,(H,19,20)(H,21,22)/t12-,14+/m0/s1 |
| InChIKey | WXOJLOMRWQRETQ-GXTWGEPZSA-N |
| XLogP | 2.83 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|