C18H14FNO4 — CID 69485115
[1-(3-fluorobenzoyl)-5-hydroxy-2-methylindol-3-yl] acetate (PubChem CID 69485115) has the molecular formula C18H14FNO4 and a molecular weight of 327.31 g/mol. Its IUPAC name is [1-(3-fluorobenzoyl)-5-hydroxy-2-methylindol-3-yl] acetate.
| Compound Name | [1-(3-fluorobenzoyl)-5-hydroxy-2-methylindol-3-yl] acetate |
|---|---|
| PubChem CID | 69485115 |
| Molecular Formula | C18H14FNO4 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | [1-(3-fluorobenzoyl)-5-hydroxy-2-methylindol-3-yl] acetate |
| SMILES | CC(=O)Oc1c(C)n(C(=O)c2cccc(F)c2)c2ccc(O)cc12 |
| InChI | InChI=1S/C18H14FNO4/c1-10-17(24-11(2)21)15-9-14(22)6-7-16(15)20(10)18(23)12-4-3-5-13(19)8-12/h3-9,22H,1-2H3 |
| InChIKey | NENCTSYRJOEHPQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |