C19H16ClNO4 — CID 69485526
(2R)-2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoic acid (PubChem CID 69485526) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is (2R)-2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoic acid.
| Compound Name | (2R)-2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 69485526 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (2R)-2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoic acid |
| SMILES | Cc1c([C@@H](C)C(=O)O)c2cc(O)ccc2n1C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H16ClNO4/c1-10(19(24)25)17-11(2)21(16-7-6-14(22)9-15(16)17)18(23)12-4-3-5-13(20)8-12/h3-10,22H,1-2H3,(H,24,25)/t10-/m1/s1 |
| InChIKey | ARORIXALJBFBAX-SNVBAGLBSA-N |
| XLogP | 4.19 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |