C22H23ClN2O3 — CID 91518735
2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]hexanamide (PubChem CID 91518735) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]hexanamide.
| Compound Name | 2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]hexanamide |
|---|---|
| PubChem CID | 91518735 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]hexanamide |
| SMILES | CCCCC(C(N)=O)c1c(C)n(C(=O)c2cccc(Cl)c2)c2ccc(O)cc12 |
| InChI | InChI=1S/C22H23ClN2O3/c1-3-4-8-17(21(24)27)20-13(2)25(19-10-9-16(26)12-18(19)20)22(28)14-6-5-7-15(23)11-14/h5-7,9-12,17,26H,3-4,8H2,1-2H3,(H2,24,27) |
| InChIKey | VKVMXFXWWYXMMJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |