C23H23ClN2O5 — CID 69487263
(3S)-3-[3-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]butanoic acid (PubChem CID 69487263) has the molecular formula C23H23ClN2O5 and a molecular weight of 442.90 g/mol. Its IUPAC name is (3S)-3-[3-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]butanoic acid.
| Compound Name | (3S)-3-[3-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 69487263 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (3S)-3-[3-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]butanoic acid |
| SMILES | Cc1c(CCC(=O)N[C@@H](C)CC(=O)O)c2cc(O)ccc2n1C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H23ClN2O5/c1-13(10-22(29)30)25-21(28)9-7-18-14(2)26(20-8-6-17(27)12-19(18)20)23(31)15-4-3-5-16(24)11-15/h3-6,8,11-13,27H,7,9-10H2,1-2H3,(H,25,28)(H,29,30)/t13-/m0/s1 |
| InChIKey | WDJSCURKOZOPBM-ZDUSSCGKSA-N |
| XLogP | 3.91 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |