About 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid
3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid (PubChem CID 69487305) has the molecular formula C22H20Cl2N2O5
and a molecular weight of 463.32 g/mol. Its IUPAC name is 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid |
| PubChem CID | 69487305 |
| Molecular Formula | C22H20Cl2N2O5 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid |
| SMILES | Cc1c(CCC(=O)NCCC(=O)O)c2cc(O)ccc2n1C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H20Cl2N2O5/c1-12-15(4-7-20(28)25-9-8-21(29)30)16-11-14(27)3-6-19(16)26(12)22(31)13-2-5-17(23)18(24)10-13/h2-3,5-6,10-11,27H,4,7-9H2,1H3,(H,25,28)(H,29,30) |
| InChIKey | MANFRTCXFDHTRR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid?
The IUPAC name of 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid (CID 69487305) is 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid.
What is the SMILES notation for 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid?
The canonical SMILES for 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid is Cc1c(CCC(=O)NCCC(=O)O)c2cc(O)ccc2n1C(=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid?
The InChIKey is MANFRTCXFDHTRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20Cl2N2O5/c1-12-15(4-7-20(28)25-9-8-21(29)30)16-11-14(27)3-6-19(16)26(12)22(31)13-2-5-17(23)18(24)10-13/h2-3,5-6,10-11,27H,4,7-9H2,1H3,(H,25,28)(H,29,30).
What are the key properties of 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid?
3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid has a molecular weight of 463.32 g/mol, XLogP of 4.17, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid is sourced from PubChem (CID 69487305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).