C44H38Cl4N4O10 — CID 87892692
2,3-bis[[(2S)-2-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoyl]amino]-4-methylpentanedioic acid (PubChem CID 87892692) has the molecular formula C44H38Cl4N4O10 and a molecular weight of 924.62 g/mol. Its IUPAC name is 2,3-bis[[(2S)-2-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoyl]amino]-4-methylpentanedioic acid.
| Compound Name | 2,3-bis[[(2S)-2-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoyl]amino]-4-methylpentanedioic acid |
|---|---|
| PubChem CID | 87892692 |
| Molecular Formula | C44H38Cl4N4O10 |
| Molecular Weight | 924.62 g/mol |
| Exact Mass | 922.13 |
| IUPAC Name | 2,3-bis[[(2S)-2-[1-(3,4-dichlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]propanoyl]amino]-4-methylpentanedioic acid |
| SMILES | Cc1c([C@H](C)C(=O)NC(C(=O)O)C(NC(=O)[C@@H](C)c2c(C)n(C(=O)c3ccc(Cl)c(Cl)c3)c3ccc(O)cc23)C(C)C(=O)O)c2cc(O)ccc2n1C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C44H38Cl4N4O10/c1-18(35-21(4)51(33-12-8-25(53)16-27(33)35)41(57)23-6-10-29(45)31(47)14-23)39(55)49-37(20(3)43(59)60)38(44(61)62)50-40(56)19(2)36-22(5)52(34-13-9-26(54)17-28(34)36)42(58)24-7-11-30(46)32(48)15-24/h6-20,37-38,53-54H,1-5H3,(H,49,55)(H,50,56)(H,59,60)(H,61,62)/t18-,19-,20?,37?,38?/m0/s1 |
| InChIKey | IENWMPCPOYAICB-GMDFHNQBSA-N |
| XLogP | 8.30 |
| TPSA | 217.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.62 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |