C22H21ClN2O5 — CID 69487096
3-[[2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetyl]amino]butanoic acid (PubChem CID 69487096) has the molecular formula C22H21ClN2O5 and a molecular weight of 428.87 g/mol. Its IUPAC name is 3-[[2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetyl]amino]butanoic acid.
| Compound Name | 3-[[2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 69487096 |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 3-[[2-[1-(3-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetyl]amino]butanoic acid |
| SMILES | Cc1c(CC(=O)NC(C)CC(=O)O)c2cc(O)ccc2n1C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21ClN2O5/c1-12(8-21(28)29)24-20(27)11-17-13(2)25(19-7-6-16(26)10-18(17)19)22(30)14-4-3-5-15(23)9-14/h3-7,9-10,12,26H,8,11H2,1-2H3,(H,24,27)(H,28,29) |
| InChIKey | JVDOWFFAEWPQOT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |