C31H22N2O2S — CID 69485333
2-(5-phenylmethoxy-3-pyridinyl)-4-(4-phenylphenoxy)thieno[2,3-c]pyridine (PubChem CID 69485333) has the molecular formula C31H22N2O2S and a molecular weight of 486.60 g/mol. Its IUPAC name is 2-(5-phenylmethoxy-3-pyridinyl)-4-(4-phenylphenoxy)thieno[2,3-c]pyridine.
| Compound Name | 2-(5-phenylmethoxy-3-pyridinyl)-4-(4-phenylphenoxy)thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 69485333 |
| Molecular Formula | C31H22N2O2S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-(5-phenylmethoxy-3-pyridinyl)-4-(4-phenylphenoxy)thieno[2,3-c]pyridine |
| SMILES | c1ccc(COc2cncc(-c3cc4c(Oc5ccc(-c6ccccc6)cc5)cncc4s3)c2)cc1 |
| InChI | InChI=1S/C31H22N2O2S/c1-3-7-22(8-4-1)21-34-27-15-25(17-32-18-27)30-16-28-29(19-33-20-31(28)36-30)35-26-13-11-24(12-14-26)23-9-5-2-6-10-23/h1-20H,21H2 |
| InChIKey | OJVLFQRXKSXZLH-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |