C25H18Cl2O2 — CID 91251080
2,4-dichloro-1-[4-(3-phenylmethoxyphenyl)phenoxy]benzene (PubChem CID 91251080) has the molecular formula C25H18Cl2O2 and a molecular weight of 421.32 g/mol. Its IUPAC name is 2,4-dichloro-1-[4-(3-phenylmethoxyphenyl)phenoxy]benzene.
| Compound Name | 2,4-dichloro-1-[4-(3-phenylmethoxyphenyl)phenoxy]benzene |
|---|---|
| PubChem CID | 91251080 |
| Molecular Formula | C25H18Cl2O2 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2,4-dichloro-1-[4-(3-phenylmethoxyphenyl)phenoxy]benzene |
| SMILES | Clc1ccc(Oc2ccc(-c3cccc(OCc4ccccc4)c3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C25H18Cl2O2/c26-21-11-14-25(24(27)16-21)29-22-12-9-19(10-13-22)20-7-4-8-23(15-20)28-17-18-5-2-1-3-6-18/h1-16H,17H2 |
| InChIKey | SPTLOEXERCRVNE-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |