C16H10Cl2O2 — CID 168526554
2-[4-(2,4-dichlorophenoxy)phenyl]furan (PubChem CID 168526554) has the molecular formula C16H10Cl2O2 and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenoxy)phenyl]furan.
| Compound Name | 2-[4-(2,4-dichlorophenoxy)phenyl]furan |
|---|---|
| PubChem CID | 168526554 |
| Molecular Formula | C16H10Cl2O2 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 2-[4-(2,4-dichlorophenoxy)phenyl]furan |
| SMILES | Clc1ccc(Oc2ccc(-c3ccco3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl2O2/c17-12-5-8-16(14(18)10-12)20-13-6-3-11(4-7-13)15-2-1-9-19-15/h1-10H |
| InChIKey | UPKCWVWDYRNQBN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |