C15H11Cl2N5O — CID 127035449
6-[4-(2,4-dichlorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 127035449) has the molecular formula C15H11Cl2N5O and a molecular weight of 348.19 g/mol. Its IUPAC name is 6-[4-(2,4-dichlorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-(2,4-dichlorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 127035449 |
| Molecular Formula | C15H11Cl2N5O |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 6-[4-(2,4-dichlorophenoxy)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2ccc(Oc3ccc(Cl)cc3Cl)cc2)n1 |
| InChI | InChI=1S/C15H11Cl2N5O/c16-9-3-6-12(11(17)7-9)23-10-4-1-8(2-5-10)13-20-14(18)22-15(19)21-13/h1-7H,(H4,18,19,20,21,22) |
| InChIKey | JHHCBNXNWJXUNZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |