C19H23NO3 — CID 69486002
4-[2-[benzyl(cyclopropyl)amino]-2-hydroxyethyl]-2-(hydroxymethyl)phenol (PubChem CID 69486002) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[2-[benzyl(cyclopropyl)amino]-2-hydroxyethyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[2-[benzyl(cyclopropyl)amino]-2-hydroxyethyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 69486002 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 4-[2-[benzyl(cyclopropyl)amino]-2-hydroxyethyl]-2-(hydroxymethyl)phenol |
| SMILES | OCc1cc(CC(O)N(Cc2ccccc2)C2CC2)ccc1O |
| InChI | InChI=1S/C19H23NO3/c21-13-16-10-15(6-9-18(16)22)11-19(23)20(17-7-8-17)12-14-4-2-1-3-5-14/h1-6,9-10,17,19,21-23H,7-8,11-13H2 |
| InChIKey | WYGBOUCSJWHBKF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|