C22H27NO2 — CID 175523569
N-benzyl-N-(1,1-dimethoxy-4-phenylbut-3-en-2-yl)cyclopropanamine (PubChem CID 175523569) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-benzyl-N-(1,1-dimethoxy-4-phenylbut-3-en-2-yl)cyclopropanamine.
| Compound Name | N-benzyl-N-(1,1-dimethoxy-4-phenylbut-3-en-2-yl)cyclopropanamine |
|---|---|
| PubChem CID | 175523569 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-benzyl-N-(1,1-dimethoxy-4-phenylbut-3-en-2-yl)cyclopropanamine |
| SMILES | COC(OC)C(C=Cc1ccccc1)N(Cc1ccccc1)C1CC1 |
| InChI | InChI=1S/C22H27NO2/c1-24-22(25-2)21(16-13-18-9-5-3-6-10-18)23(20-14-15-20)17-19-11-7-4-8-12-19/h3-13,16,20-22H,14-15,17H2,1-2H3 |
| InChIKey | UNMNIKPBWWZOLC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|