C22H28NO3P — CID 11581796
N-benzyl-N-[(E)-1-dimethoxyphosphoryl-3-phenylprop-2-enyl]-2-methylprop-2-en-1-amine (PubChem CID 11581796) has the molecular formula C22H28NO3P and a molecular weight of 385.44 g/mol. Its IUPAC name is N-benzyl-N-[(E)-1-dimethoxyphosphoryl-3-phenylprop-2-enyl]-2-methylprop-2-en-1-amine.
| Compound Name | N-benzyl-N-[(E)-1-dimethoxyphosphoryl-3-phenylprop-2-enyl]-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 11581796 |
| Molecular Formula | C22H28NO3P |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-benzyl-N-[(E)-1-dimethoxyphosphoryl-3-phenylprop-2-enyl]-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)CN(Cc1ccccc1)C(/C=C/c1ccccc1)P(=O)(OC)OC |
| InChI | InChI=1S/C22H28NO3P/c1-19(2)17-23(18-21-13-9-6-10-14-21)22(27(24,25-3)26-4)16-15-20-11-7-5-8-12-20/h5-16,22H,1,17-18H2,2-4H3/b16-15+ |
| InChIKey | BVRRIAQPUOLMHI-FOCLMDBBSA-N |
| XLogP | 5.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|