C27H31NO2 — CID 175523570
N,N-dibenzyl-1,1-dimethoxy-4-(4-methylphenyl)but-3-en-2-amine (PubChem CID 175523570) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is N,N-dibenzyl-1,1-dimethoxy-4-(4-methylphenyl)but-3-en-2-amine.
| Compound Name | N,N-dibenzyl-1,1-dimethoxy-4-(4-methylphenyl)but-3-en-2-amine |
|---|---|
| PubChem CID | 175523570 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | N,N-dibenzyl-1,1-dimethoxy-4-(4-methylphenyl)but-3-en-2-amine |
| SMILES | COC(OC)C(C=Cc1ccc(C)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H31NO2/c1-22-14-16-23(17-15-22)18-19-26(27(29-2)30-3)28(20-24-10-6-4-7-11-24)21-25-12-8-5-9-13-25/h4-19,26-27H,20-21H2,1-3H3 |
| InChIKey | ONXRACRLTLUKEF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|