C22H24N2O3 — CID 69486758
3-[ethyl(1H-indol-3-yl)carbamoyl]-5-phenylpentanoic acid (PubChem CID 69486758) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is 3-[ethyl(1H-indol-3-yl)carbamoyl]-5-phenylpentanoic acid.
| Compound Name | 3-[ethyl(1H-indol-3-yl)carbamoyl]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 69486758 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-[ethyl(1H-indol-3-yl)carbamoyl]-5-phenylpentanoic acid |
| SMILES | CCN(C(=O)C(CCc1ccccc1)CC(=O)O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H24N2O3/c1-2-24(20-15-23-19-11-7-6-10-18(19)20)22(27)17(14-21(25)26)13-12-16-8-4-3-5-9-16/h3-11,15,17,23H,2,12-14H2,1H3,(H,25,26) |
| InChIKey | GBCSJOZKMRESNT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |