C22H24N2O3 — CID 7492999
[(2R)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] 1H-indole-3-carboxylate (PubChem CID 7492999) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] 1H-indole-3-carboxylate.
| Compound Name | [(2R)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 7492999 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [(2R)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] 1H-indole-3-carboxylate |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)[C@@H](C)OC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H24N2O3/c1-15(12-13-17-8-4-3-5-9-17)24-21(25)16(2)27-22(26)19-14-23-20-11-7-6-10-18(19)20/h3-11,14-16,23H,12-13H2,1-2H3,(H,24,25)/t15-,16+/m0/s1 |
| InChIKey | MRIOIMNYQQSJDD-JKSUJKDBSA-N |
| XLogP | 3.85 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |