C49H56BrFN2O3 — CID 69492367
1-azabicyclo[2.2.2]octan-4-yl(diphenyl)methanol;[1-[2-[(4-fluorophenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol;bromide (PubChem CID 69492367) has the molecular formula C49H56BrFN2O3 and a molecular weight of 819.90 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-4-yl(diphenyl)methanol;[1-[2-[(4-fluorophenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol;bromide.
| Compound Name | 1-azabicyclo[2.2.2]octan-4-yl(diphenyl)methanol;[1-[2-[(4-fluorophenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol;bromide |
|---|---|
| PubChem CID | 69492367 |
| Molecular Formula | C49H56BrFN2O3 |
| Molecular Weight | 819.90 g/mol |
| Exact Mass | 818.35 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-4-yl(diphenyl)methanol;[1-[2-[(4-fluorophenyl)methoxy]ethyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol;bromide |
| SMILES | OC(c1ccccc1)(c1ccccc1)C12CCN(CC1)CC2.OC(c1ccccc1)(c1ccccc1)C12CC[N+](CCOCc3ccc(F)cc3)(CC1)CC2.[Br-] |
| InChI | InChI=1S/C29H33FNO2.C20H23NO.BrH/c30-27-13-11-24(12-14-27)23-33-22-21-31-18-15-28(16-19-31,17-20-31)29(32,25-7-3-1-4-8-25)26-9-5-2-6-10-26;22-20(17-7-3-1-4-8-17,18-9-5-2-6-10-18)19-11-14-21(15-12-19)16-13-19;/h1-14,32H,15-23H2;1-10,22H,11-16H2;1H/q+1;;/p-1 |
| InChIKey | MRNSPOJWHBLEBD-UHFFFAOYSA-M |
| XLogP | 5.69 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.90 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|