C23H41NO — CID 69493299
2,6-bis(2,2-dimethylpropyl)-4-[(hexylamino)methyl]phenol (PubChem CID 69493299) has the molecular formula C23H41NO and a molecular weight of 347.59 g/mol. Its IUPAC name is 2,6-bis(2,2-dimethylpropyl)-4-[(hexylamino)methyl]phenol.
| Compound Name | 2,6-bis(2,2-dimethylpropyl)-4-[(hexylamino)methyl]phenol |
|---|---|
| PubChem CID | 69493299 |
| Molecular Formula | C23H41NO |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 347.32 |
| IUPAC Name | 2,6-bis(2,2-dimethylpropyl)-4-[(hexylamino)methyl]phenol |
| SMILES | CCCCCCNCc1cc(CC(C)(C)C)c(O)c(CC(C)(C)C)c1 |
| InChI | InChI=1S/C23H41NO/c1-8-9-10-11-12-24-17-18-13-19(15-22(2,3)4)21(25)20(14-18)16-23(5,6)7/h13-14,24-25H,8-12,15-17H2,1-7H3 |
| InChIKey | BHCVIUWMBVPSJW-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|