C28H31FN2O3 — CID 69494822
methyl N-benzyl-N-[2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-methoxyphenyl]carbamate (PubChem CID 69494822) has the molecular formula C28H31FN2O3 and a molecular weight of 462.57 g/mol. Its IUPAC name is methyl N-benzyl-N-[2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-methoxyphenyl]carbamate.
| Compound Name | methyl N-benzyl-N-[2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 69494822 |
| Molecular Formula | C28H31FN2O3 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | methyl N-benzyl-N-[2-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-3-methoxyphenyl]carbamate |
| SMILES | COC(=O)N(Cc1ccccc1)c1cccc(OC)c1C1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H31FN2O3/c1-33-26-10-6-9-25(31(28(32)34-2)20-21-7-4-3-5-8-21)27(26)23-15-17-30(18-16-23)19-22-11-13-24(29)14-12-22/h3-14,23H,15-20H2,1-2H3 |
| InChIKey | LGINAMAUNKNFAH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |