C28H26N2O3 — CID 69496588
2-[6-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-2-pyridinyl]-4-ethylbenzoic acid (PubChem CID 69496588) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[6-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-2-pyridinyl]-4-ethylbenzoic acid.
| Compound Name | 2-[6-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-2-pyridinyl]-4-ethylbenzoic acid |
|---|---|
| PubChem CID | 69496588 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[6-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-2-pyridinyl]-4-ethylbenzoic acid |
| SMILES | CCc1ccc(C(=O)O)c(-c2cccc(Oc3cc(C)cc(-c4cccc(CN)c4)c3)n2)c1 |
| InChI | InChI=1S/C28H26N2O3/c1-3-19-10-11-24(28(31)32)25(15-19)26-8-5-9-27(30-26)33-23-13-18(2)12-22(16-23)21-7-4-6-20(14-21)17-29/h4-16H,3,17,29H2,1-2H3,(H,31,32) |
| InChIKey | LCVWDODXKRFQAR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |