C26H23N3O2 — CID 69496794
2-[6-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-2-pyridinyl]benzamide (PubChem CID 69496794) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[6-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-2-pyridinyl]benzamide.
| Compound Name | 2-[6-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 69496794 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[6-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-2-pyridinyl]benzamide |
| SMILES | Cc1cc(Oc2cccc(-c3ccccc3C(N)=O)n2)cc(-c2cccc(CN)c2)c1 |
| InChI | InChI=1S/C26H23N3O2/c1-17-12-20(19-7-4-6-18(14-19)16-27)15-21(13-17)31-25-11-5-10-24(29-25)22-8-2-3-9-23(22)26(28)30/h2-15H,16,27H2,1H3,(H2,28,30) |
| InChIKey | UNVCBYVCAAAKII-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |