C28H25NO3 — CID 69497026
2-[3-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-5-methylphenyl]benzoic acid (PubChem CID 69497026) has the molecular formula C28H25NO3 and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-[3-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-5-methylphenyl]benzoic acid.
| Compound Name | 2-[3-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-5-methylphenyl]benzoic acid |
|---|---|
| PubChem CID | 69497026 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[3-[3-[3-(aminomethyl)phenyl]-5-methylphenoxy]-5-methylphenyl]benzoic acid |
| SMILES | Cc1cc(Oc2cc(C)cc(-c3ccccc3C(=O)O)c2)cc(-c2cccc(CN)c2)c1 |
| InChI | InChI=1S/C28H25NO3/c1-18-10-22(21-7-5-6-20(14-21)17-29)15-24(12-18)32-25-13-19(2)11-23(16-25)26-8-3-4-9-27(26)28(30)31/h3-16H,17,29H2,1-2H3,(H,30,31) |
| InChIKey | LKOSYLPFDGKNAW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |