C21H19F3N4O — CID 142799700
2-[3-[[[4-(aminomethyl)-6-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]benzamide (PubChem CID 142799700) has the molecular formula C21H19F3N4O and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-[3-[[[4-(aminomethyl)-6-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]benzamide.
| Compound Name | 2-[3-[[[4-(aminomethyl)-6-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 142799700 |
| Molecular Formula | C21H19F3N4O |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-[3-[[[4-(aminomethyl)-6-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]benzamide |
| SMILES | NCc1cc(NCc2cccc(-c3ccccc3C(N)=O)c2)nc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F3N4O/c22-21(23,24)18-9-14(11-25)10-19(28-18)27-12-13-4-3-5-15(8-13)16-6-1-2-7-17(16)20(26)29/h1-10H,11-12,25H2,(H2,26,29)(H,27,28) |
| InChIKey | BQFJPUJRSBHHKS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |