C25H24ClNO4 — CID 69499499
1,3-benzodioxol-5-yl-(4-chlorophenyl)-[4-(morpholin-4-ylmethyl)phenyl]methanol (PubChem CID 69499499) has the molecular formula C25H24ClNO4 and a molecular weight of 437.92 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(4-chlorophenyl)-[4-(morpholin-4-ylmethyl)phenyl]methanol.
| Compound Name | 1,3-benzodioxol-5-yl-(4-chlorophenyl)-[4-(morpholin-4-ylmethyl)phenyl]methanol |
|---|---|
| PubChem CID | 69499499 |
| Molecular Formula | C25H24ClNO4 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(4-chlorophenyl)-[4-(morpholin-4-ylmethyl)phenyl]methanol |
| SMILES | OC(c1ccc(Cl)cc1)(c1ccc(CN2CCOCC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H24ClNO4/c26-22-8-5-20(6-9-22)25(28,21-7-10-23-24(15-21)31-17-30-23)19-3-1-18(2-4-19)16-27-11-13-29-14-12-27/h1-10,15,28H,11-14,16-17H2 |
| InChIKey | MEAPNBWEARHMMT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|