C15H18N2O4 — CID 695179
ethyl (3R)-3-hydroxy-5-methyl-2-(3-methylbenzoyl)-4H-pyrazole-3-carboxylate (PubChem CID 695179) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl (3R)-3-hydroxy-5-methyl-2-(3-methylbenzoyl)-4H-pyrazole-3-carboxylate.
| Compound Name | ethyl (3R)-3-hydroxy-5-methyl-2-(3-methylbenzoyl)-4H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 695179 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | ethyl (3R)-3-hydroxy-5-methyl-2-(3-methylbenzoyl)-4H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)CC(C)=NN1C(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-4-21-14(19)15(20)9-11(3)16-17(15)13(18)12-7-5-6-10(2)8-12/h5-8,20H,4,9H2,1-3H3/t15-/m1/s1 |
| InChIKey | MQULTXFIFRULDJ-OAHLLOKOSA-N |
| XLogP | 1.47 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |