C19H19BrN2O2 — CID 7169181
[(5R)-5-(4-bromophenyl)-3-ethyl-5-hydroxy-4H-pyrazol-1-yl]-(3-methylphenyl)methanone (PubChem CID 7169181) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is [(5R)-5-(4-bromophenyl)-3-ethyl-5-hydroxy-4H-pyrazol-1-yl]-(3-methylphenyl)methanone.
| Compound Name | [(5R)-5-(4-bromophenyl)-3-ethyl-5-hydroxy-4H-pyrazol-1-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 7169181 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | [(5R)-5-(4-bromophenyl)-3-ethyl-5-hydroxy-4H-pyrazol-1-yl]-(3-methylphenyl)methanone |
| SMILES | CCC1=NN(C(=O)c2cccc(C)c2)[C@](O)(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H19BrN2O2/c1-3-17-12-19(24,15-7-9-16(20)10-8-15)22(21-17)18(23)14-6-4-5-13(2)11-14/h4-11,24H,3,12H2,1-2H3/t19-/m1/s1 |
| InChIKey | ONBDABJGYOFPAF-LJQANCHMSA-N |
| XLogP | 4.21 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |