C13H9ClNO3S- — CID 6954275
2-[(4-chlorobenzoyl)amino]-5-methylthiophene-3-carboxylate (PubChem CID 6954275) has the molecular formula C13H9ClNO3S- and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-[(4-chlorobenzoyl)amino]-5-methylthiophene-3-carboxylate.
| Compound Name | 2-[(4-chlorobenzoyl)amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 6954275 |
| Molecular Formula | C13H9ClNO3S- |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 2-[(4-chlorobenzoyl)amino]-5-methylthiophene-3-carboxylate |
| SMILES | Cc1cc(C(=O)[O-])c(NC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H10ClNO3S/c1-7-6-10(13(17)18)12(19-7)15-11(16)8-2-4-9(14)5-3-8/h2-6H,1H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | YFDOKEVVHSXUTQ-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |