C15H13N5O2S — CID 75434199
5-methyl-2-[[4-(triazol-1-yl)benzoyl]amino]thiophene-3-carboxamide (PubChem CID 75434199) has the molecular formula C15H13N5O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is 5-methyl-2-[[4-(triazol-1-yl)benzoyl]amino]thiophene-3-carboxamide.
| Compound Name | 5-methyl-2-[[4-(triazol-1-yl)benzoyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 75434199 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 5-methyl-2-[[4-(triazol-1-yl)benzoyl]amino]thiophene-3-carboxamide |
| SMILES | Cc1cc(C(N)=O)c(NC(=O)c2ccc(-n3ccnn3)cc2)s1 |
| InChI | InChI=1S/C15H13N5O2S/c1-9-8-12(13(16)21)15(23-9)18-14(22)10-2-4-11(5-3-10)20-7-6-17-19-20/h2-8H,1H3,(H2,16,21)(H,18,22) |
| InChIKey | HMBLITOAGLZYMN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |