C22H19N2O5S- — CID 6958792
3-[[4-[methyl-(3-methylphenyl)sulfamoyl]benzoyl]amino]benzoate (PubChem CID 6958792) has the molecular formula C22H19N2O5S- and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-[[4-[methyl-(3-methylphenyl)sulfamoyl]benzoyl]amino]benzoate.
| Compound Name | 3-[[4-[methyl-(3-methylphenyl)sulfamoyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 6958792 |
| Molecular Formula | C22H19N2O5S- |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 3-[[4-[methyl-(3-methylphenyl)sulfamoyl]benzoyl]amino]benzoate |
| SMILES | Cc1cccc(N(C)S(=O)(=O)c2ccc(C(=O)Nc3cccc(C(=O)[O-])c3)cc2)c1 |
| InChI | InChI=1S/C22H20N2O5S/c1-15-5-3-8-19(13-15)24(2)30(28,29)20-11-9-16(10-12-20)21(25)23-18-7-4-6-17(14-18)22(26)27/h3-14H,1-2H3,(H,23,25)(H,26,27)/p-1 |
| InChIKey | UKTPUDADGLYLQJ-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |