C17H17N3O3S — CID 696014
4-(4-imidazo[1,2-a]pyridin-2-ylphenyl)sulfonylmorpholine (PubChem CID 696014) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-(4-imidazo[1,2-a]pyridin-2-ylphenyl)sulfonylmorpholine.
| Compound Name | 4-(4-imidazo[1,2-a]pyridin-2-ylphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 696014 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-(4-imidazo[1,2-a]pyridin-2-ylphenyl)sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(-c2cn3ccccc3n2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C17H17N3O3S/c21-24(22,20-9-11-23-12-10-20)15-6-4-14(5-7-15)16-13-19-8-2-1-3-17(19)18-16/h1-8,13H,9-12H2 |
| InChIKey | FAHVTMMXGGKBGO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |