C20H22INO3 — CID 6961201
ethyl (4R)-2-ethyl-4-(2-iodophenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 6961201) has the molecular formula C20H22INO3 and a molecular weight of 451.30 g/mol. Its IUPAC name is ethyl (4R)-2-ethyl-4-(2-iodophenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | ethyl (4R)-2-ethyl-4-(2-iodophenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 6961201 |
| Molecular Formula | C20H22INO3 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | ethyl (4R)-2-ethyl-4-(2-iodophenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C(CC)=NC2=C(C(=O)CCC2)[C@@H]1c1ccccc1I |
| InChI | InChI=1S/C20H22INO3/c1-3-14-19(20(24)25-4-2)17(12-8-5-6-9-13(12)21)18-15(22-14)10-7-11-16(18)23/h5-6,8-9,17,19H,3-4,7,10-11H2,1-2H3/t17-,19?/m0/s1 |
| InChIKey | MYEZZPFNJOITJZ-KKFHFHRHSA-N |
| XLogP | 4.43 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|