C13H23N3+2 — CID 6965606
[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl-(pyridin-3-ylmethyl)azanium (PubChem CID 6965606) has the molecular formula C13H23N3+2 and a molecular weight of 221.35 g/mol. Its IUPAC name is [(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl-(pyridin-3-ylmethyl)azanium.
| Compound Name | [(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl-(pyridin-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 6965606 |
| Molecular Formula | C13H23N3+2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | [(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl-(pyridin-3-ylmethyl)azanium |
| SMILES | CC[NH+]1CCC[C@@H]1C[NH2+]Cc1cccnc1 |
| InChI | InChI=1S/C13H21N3/c1-2-16-8-4-6-13(16)11-15-10-12-5-3-7-14-9-12/h3,5,7,9,13,15H,2,4,6,8,10-11H2,1H3/p+2/t13-/m1/s1 |
| InChIKey | LOMXQNKDBFAGGB-CYBMUJFWSA-P |
| XLogP | -0.79 |
| TPSA | 33.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |