C14H23N2+ — CID 6967900
methyl-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]azanium (PubChem CID 6967900) has the molecular formula C14H23N2+ and a molecular weight of 219.35 g/mol. Its IUPAC name is methyl-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]azanium.
| Compound Name | methyl-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]azanium |
|---|---|
| PubChem CID | 6967900 |
| Molecular Formula | C14H23N2+ |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | methyl-[(1-propyl-3,4-dihydro-2H-quinolin-6-yl)methyl]azanium |
| SMILES | CCCN1CCCc2cc(C[NH2+]C)ccc21 |
| InChI | InChI=1S/C14H22N2/c1-3-8-16-9-4-5-13-10-12(11-15-2)6-7-14(13)16/h6-7,10,15H,3-5,8-9,11H2,1-2H3/p+1 |
| InChIKey | GSNMWFIWSGPSCG-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|