C26H27N2O3S+ — CID 6969563
4-methyl-N-[2-[(1R)-1-morpholin-4-ium-4-yl-3-phenylprop-2-ynyl]phenyl]benzenesulfonamide (PubChem CID 6969563) has the molecular formula C26H27N2O3S+ and a molecular weight of 447.58 g/mol. Its IUPAC name is 4-methyl-N-[2-[(1R)-1-morpholin-4-ium-4-yl-3-phenylprop-2-ynyl]phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[(1R)-1-morpholin-4-ium-4-yl-3-phenylprop-2-ynyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6969563 |
| Molecular Formula | C26H27N2O3S+ |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-methyl-N-[2-[(1R)-1-morpholin-4-ium-4-yl-3-phenylprop-2-ynyl]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2[C@@H](C#Cc2ccccc2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C26H26N2O3S/c1-21-11-14-23(15-12-21)32(29,30)27-25-10-6-5-9-24(25)26(28-17-19-31-20-18-28)16-13-22-7-3-2-4-8-22/h2-12,14-15,26-27H,17-20H2,1H3/p+1/t26-/m1/s1 |
| InChIKey | QBTFFVZEKPTZAR-AREMUKBSSA-O |
| XLogP | 2.80 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|