C22H21N4S2+ — CID 6969583
1-(6-benzyl-3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl)-3-phenylthiourea (PubChem CID 6969583) has the molecular formula C22H21N4S2+ and a molecular weight of 405.57 g/mol. Its IUPAC name is 1-(6-benzyl-3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl)-3-phenylthiourea.
| Compound Name | 1-(6-benzyl-3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl)-3-phenylthiourea |
|---|---|
| PubChem CID | 6969583 |
| Molecular Formula | C22H21N4S2+ |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-(6-benzyl-3-cyano-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-2-yl)-3-phenylthiourea |
| SMILES | N#Cc1c(NC(=S)Nc2ccccc2)sc2c1CC[NH+](Cc1ccccc1)C2 |
| InChI | InChI=1S/C22H20N4S2/c23-13-19-18-11-12-26(14-16-7-3-1-4-8-16)15-20(18)28-21(19)25-22(27)24-17-9-5-2-6-10-17/h1-10H,11-12,14-15H2,(H2,24,25,27)/p+1 |
| InChIKey | BNCHOUXHIKSPDQ-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 52.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|