C18H19N3OS2 — CID 1130541
1-benzyl-3-(3-cyano-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-2-yl)thiourea (PubChem CID 1130541) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-benzyl-3-(3-cyano-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-2-yl)thiourea.
| Compound Name | 1-benzyl-3-(3-cyano-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-2-yl)thiourea |
|---|---|
| PubChem CID | 1130541 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-benzyl-3-(3-cyano-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-2-yl)thiourea |
| SMILES | CC1(C)Cc2c(sc(NC(=S)NCc3ccccc3)c2C#N)CO1 |
| InChI | InChI=1S/C18H19N3OS2/c1-18(2)8-13-14(9-19)16(24-15(13)11-22-18)21-17(23)20-10-12-6-4-3-5-7-12/h3-7H,8,10-11H2,1-2H3,(H2,20,21,23) |
| InChIKey | STUHECVHGIEQOQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|