C21H22N3O6- — CID 6970999
2-[(Z)-[[(3R)-6-tert-butyl-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-methyl-4-nitrophenolate (PubChem CID 6970999) has the molecular formula C21H22N3O6- and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-[(Z)-[[(3R)-6-tert-butyl-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-methyl-4-nitrophenolate.
| Compound Name | 2-[(Z)-[[(3R)-6-tert-butyl-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-methyl-4-nitrophenolate |
|---|---|
| PubChem CID | 6970999 |
| Molecular Formula | C21H22N3O6- |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[(Z)-[[(3R)-6-tert-butyl-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]-6-methyl-4-nitrophenolate |
| SMILES | Cc1cc([N+](=O)[O-])cc(/C=N\NC(=O)[C@H]2COc3ccc(C(C)(C)C)cc3O2)c1[O-] |
| InChI | InChI=1S/C21H23N3O6/c1-12-7-15(24(27)28)8-13(19(12)25)10-22-23-20(26)18-11-29-16-6-5-14(21(2,3)4)9-17(16)30-18/h5-10,18,25H,11H2,1-4H3,(H,23,26)/p-1/b22-10-/t18-/m1/s1 |
| InChIKey | LAXWHELJQPEQQM-CIQOZVAXSA-M |
| XLogP | 2.56 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|