C24H22ClN3O6 — CID 6863066
(3S)-6-tert-butyl-N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 6863066) has the molecular formula C24H22ClN3O6 and a molecular weight of 483.91 g/mol. Its IUPAC name is (3S)-6-tert-butyl-N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-6-tert-butyl-N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 6863066 |
| Molecular Formula | C24H22ClN3O6 |
| Molecular Weight | 483.91 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | (3S)-6-tert-butyl-N-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc2c(c1)O[C@H](C(=O)N/N=C/c1ccc(-c3cc([N+](=O)[O-])ccc3Cl)o1)CO2 |
| InChI | InChI=1S/C24H22ClN3O6/c1-24(2,3)14-4-8-20-21(10-14)34-22(13-32-20)23(29)27-26-12-16-6-9-19(33-16)17-11-15(28(30)31)5-7-18(17)25/h4-12,22H,13H2,1-3H3,(H,27,29)/b26-12+/t22-/m0/s1 |
| InChIKey | NYLDUQSVGYJISB-ORMFSKTFSA-N |
| XLogP | 5.10 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.91 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|