C12H20F3N3O — CID 69713225
N-[4-(trifluoromethyl)cyclohexyl]piperazine-1-carboxamide (PubChem CID 69713225) has the molecular formula C12H20F3N3O and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)cyclohexyl]piperazine-1-carboxamide.
| Compound Name | N-[4-(trifluoromethyl)cyclohexyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 69713225 |
| Molecular Formula | C12H20F3N3O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[4-(trifluoromethyl)cyclohexyl]piperazine-1-carboxamide |
| SMILES | C1CC(CCC1C(F)(F)F)NC(=O)N2CCNCC2 |
| InChI | InChI=1S/C12H20F3N3O/c13-12(14,15)9-1-3-10(4-2-9)17-11(19)18-7-5-16-6-8-18/h9-10,16H,1-8H2,(H,17,19) |
| InChIKey | ZBWBDYONPRDOKV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 44.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | 308 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |