About benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate
benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 6975629) has the molecular formula C19H20F3N3O3
and a molecular weight of 395.38 g/mol. Its IUPAC name is benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| PubChem CID | 6975629 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | C[C@H]1CN(c2ncc(C(=O)OCc3ccccc3)c(C(F)(F)F)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-12-9-25(10-13(2)28-12)18-23-8-15(16(24-18)19(20,21)22)17(26)27-11-14-6-4-3-5-7-14/h3-8,12-13H,9-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | VKPMETAQOIDOPZ-STQMWFEESA-N |
| XLogP | 3.47 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate?
The IUPAC name of benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate (CID 6975629) is benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate.
What is the SMILES notation for benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate?
The canonical SMILES for benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate is C[C@H]1CN(c2ncc(C(=O)OCc3ccccc3)c(C(F)(F)F)n2)C[C@H](C)O1.
What is the InChIKey of benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate?
The InChIKey is VKPMETAQOIDOPZ-STQMWFEESA-N. The full InChI is InChI=1S/C19H20F3N3O3/c1-12-9-25(10-13(2)28-12)18-23-8-15(16(24-18)19(20,21)22)17(26)27-11-14-6-4-3-5-7-14/h3-8,12-13H,9-11H2,1-2H3/t12-,13-/m0/s1.
What are the key properties of benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate?
benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate has a molecular weight of 395.38 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-(trifluoromethyl)pyrimidine-5-carboxylate is sourced from PubChem (CID 6975629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).