C18H18N2 — CID 6976613
(3aR)-2-benzyl-3,3a,4,5-tetrahydrobenzo[g]indazole (PubChem CID 6976613) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is (3aR)-2-benzyl-3,3a,4,5-tetrahydrobenzo[g]indazole.
| Compound Name | (3aR)-2-benzyl-3,3a,4,5-tetrahydrobenzo[g]indazole |
|---|---|
| PubChem CID | 6976613 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (3aR)-2-benzyl-3,3a,4,5-tetrahydrobenzo[g]indazole |
| SMILES | c1ccc(CN2C[C@H]3CCc4ccccc4C3=N2)cc1 |
| InChI | InChI=1S/C18H18N2/c1-2-6-14(7-3-1)12-20-13-16-11-10-15-8-4-5-9-17(15)18(16)19-20/h1-9,16H,10-13H2/t16-/m1/s1 |
| InChIKey | GBZDTOMDVBANOK-MRXNPFEDSA-N |
| XLogP | 3.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |