C26H24Cl2N2O4S — CID 6984424
(4S,4aR)-2-[(2,4-dichlorophenyl)methylsulfanyl]-5-oxo-4-(3,4,5-trimethoxyphenyl)-4a,6,7,8-tetrahydro-4H-quinoline-3-carbonitrile (PubChem CID 6984424) has the molecular formula C26H24Cl2N2O4S and a molecular weight of 531.46 g/mol. Its IUPAC name is (4S,4aR)-2-[(2,4-dichlorophenyl)methylsulfanyl]-5-oxo-4-(3,4,5-trimethoxyphenyl)-4a,6,7,8-tetrahydro-4H-quinoline-3-carbonitrile.
| Compound Name | (4S,4aR)-2-[(2,4-dichlorophenyl)methylsulfanyl]-5-oxo-4-(3,4,5-trimethoxyphenyl)-4a,6,7,8-tetrahydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 6984424 |
| Molecular Formula | C26H24Cl2N2O4S |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | (4S,4aR)-2-[(2,4-dichlorophenyl)methylsulfanyl]-5-oxo-4-(3,4,5-trimethoxyphenyl)-4a,6,7,8-tetrahydro-4H-quinoline-3-carbonitrile |
| SMILES | COc1cc([C@H]2C(C#N)=C(SCc3ccc(Cl)cc3Cl)N=C3CCCC(=O)[C@@H]32)cc(OC)c1OC |
| InChI | InChI=1S/C26H24Cl2N2O4S/c1-32-21-9-15(10-22(33-2)25(21)34-3)23-17(12-29)26(30-19-5-4-6-20(31)24(19)23)35-13-14-7-8-16(27)11-18(14)28/h7-11,23-24H,4-6,13H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | XQMIHPJUKXHQIH-BJKOFHAPSA-N |
| XLogP | 6.60 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |