C23H26ClNO4 — CID 6964277
(9S)-9-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione (PubChem CID 6964277) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is (9S)-9-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione.
| Compound Name | (9S)-9-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 6964277 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (9S)-9-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
| SMILES | COc1cc([C@H]2C3=C(CCCC3=O)N=C3CCCC(=O)C32)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C23H26ClNO4/c1-12(2)29-23-14(24)10-13(11-19(23)28-3)20-21-15(6-4-8-17(21)26)25-16-7-5-9-18(27)22(16)20/h10-12,20-21H,4-9H2,1-3H3/t20-,21?/m1/s1 |
| InChIKey | VCJDPEVSNWHQJI-VQCQRNETSA-N |
| XLogP | 5.05 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |