C27H27NO3 — CID 7381157
(9S)-9-[3-[(4-methylphenyl)methoxy]phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione (PubChem CID 7381157) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is (9S)-9-[3-[(4-methylphenyl)methoxy]phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione.
| Compound Name | (9S)-9-[3-[(4-methylphenyl)methoxy]phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 7381157 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (9S)-9-[3-[(4-methylphenyl)methoxy]phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
| SMILES | Cc1ccc(COc2cccc([C@H]3C4=C(CCCC4=O)N=C4CCCC(=O)C43)c2)cc1 |
| InChI | InChI=1S/C27H27NO3/c1-17-11-13-18(14-12-17)16-31-20-6-2-5-19(15-20)25-26-21(7-3-9-23(26)29)28-22-8-4-10-24(30)27(22)25/h2,5-6,11-15,25-26H,3-4,7-10,16H2,1H3/t25-,26?/m1/s1 |
| InChIKey | TVEMOFMMIXODRP-DCWQJPKNSA-N |
| XLogP | 5.49 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |