C22H21Cl2NO3 — CID 7317317
(9S)-9-(3,5-dichloro-4-prop-2-enoxyphenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione (PubChem CID 7317317) has the molecular formula C22H21Cl2NO3 and a molecular weight of 418.32 g/mol. Its IUPAC name is (9S)-9-(3,5-dichloro-4-prop-2-enoxyphenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione.
| Compound Name | (9S)-9-(3,5-dichloro-4-prop-2-enoxyphenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 7317317 |
| Molecular Formula | C22H21Cl2NO3 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | (9S)-9-(3,5-dichloro-4-prop-2-enoxyphenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
| SMILES | C=CCOc1c(Cl)cc([C@H]2C3=C(CCCC3=O)N=C3CCCC(=O)C32)cc1Cl |
| InChI | InChI=1S/C22H21Cl2NO3/c1-2-9-28-22-13(23)10-12(11-14(22)24)19-20-15(5-3-7-17(20)26)25-16-6-4-8-18(27)21(16)19/h2,10-11,19-20H,1,3-9H2/t19-,20?/m1/s1 |
| InChIKey | MUKWLKOKHLBERZ-FIWHBWSRSA-N |
| XLogP | 5.47 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|