C19H17Cl2NO2 — CID 6965173
(9S)-9-(2,4-dichlorophenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione (PubChem CID 6965173) has the molecular formula C19H17Cl2NO2 and a molecular weight of 362.26 g/mol. Its IUPAC name is (9S)-9-(2,4-dichlorophenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione.
| Compound Name | (9S)-9-(2,4-dichlorophenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 6965173 |
| Molecular Formula | C19H17Cl2NO2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (9S)-9-(2,4-dichlorophenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
| SMILES | O=C1CCCC2=C1[C@@H](c1ccc(Cl)cc1Cl)C1C(=O)CCCC1=N2 |
| InChI | InChI=1S/C19H17Cl2NO2/c20-10-7-8-11(12(21)9-10)17-18-13(3-1-5-15(18)23)22-14-4-2-6-16(24)19(14)17/h7-9,17-18H,1-6H2/t17-,18?/m0/s1 |
| InChIKey | LQYSUTZQMIDXRB-ZENAZSQFSA-N |
| XLogP | 4.91 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |